C10H15F3N4O3 — CID 103217738
[1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine (PubChem CID 103217738) has the molecular formula C10H15F3N4O3 and a molecular weight of 296.25 g/mol. Its IUPAC name is [1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine.
| Compound Name | [1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103217738 |
| Molecular Formula | C10H15F3N4O3 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | [1-(3,5-dimethoxypyrazin-2-yl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
| SMILES | COc1cnc(C(COCC(F)(F)F)NN)c(OC)n1 |
| InChI | InChI=1S/C10H15F3N4O3/c1-18-7-3-15-8(9(16-7)19-2)6(17-14)4-20-5-10(11,12)13/h3,6,17H,4-5,14H2,1-2H3 |
| InChIKey | JOMFUFNIISYJIF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|