C10H15F3N4O2 — CID 103151435
[1-(3-methoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151435) has the molecular formula C10H15F3N4O2 and a molecular weight of 280.25 g/mol. Its IUPAC name is [1-(3-methoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(3-methoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151435 |
| Molecular Formula | C10H15F3N4O2 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [1-(3-methoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | COc1nccnc1C(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C10H15F3N4O2/c1-18-9-8(15-3-4-16-9)7(17-14)2-5-19-6-10(11,12)13/h3-4,7,17H,2,5-6,14H2,1H3 |
| InChIKey | SJNVOVPEQKAXML-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|