C9H13F3N4O — CID 103151692
[1-pyrazin-2-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103151692) has the molecular formula C9H13F3N4O and a molecular weight of 250.22 g/mol. Its IUPAC name is [1-pyrazin-2-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-pyrazin-2-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151692 |
| Molecular Formula | C9H13F3N4O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [1-pyrazin-2-yl-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H13F3N4O/c10-9(11,12)6-17-4-1-7(16-13)8-5-14-2-3-15-8/h2-3,5,7,16H,1,4,6,13H2 |
| InChIKey | IQULTTLPVNXBQL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|