C9H14F2N4O — CID 103152030
[3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropyl]hydrazine (PubChem CID 103152030) has the molecular formula C9H14F2N4O and a molecular weight of 232.23 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropyl]hydrazine.
| Compound Name | [3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 103152030 |
| Molecular Formula | C9H14F2N4O |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-1-pyrazin-2-ylpropyl]hydrazine |
| SMILES | NNC(CCOCC(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H14F2N4O/c10-9(11)6-16-4-1-7(15-12)8-5-13-2-3-14-8/h2-3,5,7,9,15H,1,4,6,12H2 |
| InChIKey | IGRNUQOISXRMFR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|