C9H12F4N4O — CID 103477583
[1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine (PubChem CID 103477583) has the molecular formula C9H12F4N4O and a molecular weight of 268.21 g/mol. Its IUPAC name is [1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine.
| Compound Name | [1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103477583 |
| Molecular Formula | C9H12F4N4O |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | [1-pyrazin-2-yl-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)c1cnccn1 |
| InChI | InChI=1S/C9H12F4N4O/c10-8(11)9(12,13)5-18-4-7(17-14)6-3-15-1-2-16-6/h1-3,7-8,17H,4-5,14H2 |
| InChIKey | RAWLBKNFEPSFNL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|