C10H14F4N4O2 — CID 103477552
[1-(3-methoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine (PubChem CID 103477552) has the molecular formula C10H14F4N4O2 and a molecular weight of 298.24 g/mol. Its IUPAC name is [1-(3-methoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine.
| Compound Name | [1-(3-methoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 103477552 |
| Molecular Formula | C10H14F4N4O2 |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [1-(3-methoxypyrazin-2-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]hydrazine |
| SMILES | COc1nccnc1C(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C10H14F4N4O2/c1-19-8-7(16-2-3-17-8)6(18-15)4-20-5-10(13,14)9(11)12/h2-3,6,9,18H,4-5,15H2,1H3 |
| InChIKey | RRJDEWQQXIRZKK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|