C10H16F2N4O2 — CID 103151753
[3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propyl]hydrazine (PubChem CID 103151753) has the molecular formula C10H16F2N4O2 and a molecular weight of 262.26 g/mol. Its IUPAC name is [3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propyl]hydrazine.
| Compound Name | [3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propyl]hydrazine |
|---|---|
| PubChem CID | 103151753 |
| Molecular Formula | C10H16F2N4O2 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)propyl]hydrazine |
| SMILES | COc1nccnc1C(CCOCC(F)F)NN |
| InChI | InChI=1S/C10H16F2N4O2/c1-17-10-9(14-3-4-15-10)7(16-13)2-5-18-6-8(11)12/h3-4,7-8,16H,2,5-6,13H2,1H3 |
| InChIKey | DFQRPCPPJDMGLT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|