C13H21F2N3O2 — CID 103149941
3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)-N-propylpropan-1-amine (PubChem CID 103149941) has the molecular formula C13H21F2N3O2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)-N-propylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 103149941 |
| Molecular Formula | C13H21F2N3O2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(3-methoxypyrazin-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCNC(CCOCC(F)F)c1nccnc1OC |
| InChI | InChI=1S/C13H21F2N3O2/c1-3-5-16-10(4-8-20-9-11(14)15)12-13(19-2)18-7-6-17-12/h6-7,10-11,16H,3-5,8-9H2,1-2H3 |
| InChIKey | XNIVTJLJRAZCRM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|