C11H17F3N4O3 — CID 103217739
[1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine (PubChem CID 103217739) has the molecular formula C11H17F3N4O3 and a molecular weight of 310.28 g/mol. Its IUPAC name is [1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103217739 |
| Molecular Formula | C11H17F3N4O3 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [1-(3,5-dimethoxypyrazin-2-yl)-3-(2,2,2-trifluoroethoxy)propyl]hydrazine |
| SMILES | COc1cnc(C(CCOCC(F)(F)F)NN)c(OC)n1 |
| InChI | InChI=1S/C11H17F3N4O3/c1-19-8-5-16-9(10(17-8)20-2)7(18-15)3-4-21-6-11(12,13)14/h5,7,18H,3-4,6,15H2,1-2H3 |
| InChIKey | QUZDAVWFHPRADG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|