C14H12F3NO2 — CID 103231545
3,3,3-trifluoro-2-[(naphthalen-1-ylamino)methyl]propanoic acid (PubChem CID 103231545) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(naphthalen-1-ylamino)methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(naphthalen-1-ylamino)methyl]propanoic acid |
|---|---|
| PubChem CID | 103231545 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3,3,3-trifluoro-2-[(naphthalen-1-ylamino)methyl]propanoic acid |
| SMILES | O=C(O)C(CNc1cccc2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)11(13(19)20)8-18-12-7-3-5-9-4-1-2-6-10(9)12/h1-7,11,18H,8H2,(H,19,20) |
| InChIKey | ZRJIEEHSZFKBQT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |