C12H13F3N2O3 — CID 103233912
2-[(3-acetamidoanilino)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 103233912) has the molecular formula C12H13F3N2O3 and a molecular weight of 290.24 g/mol. Its IUPAC name is 2-[(3-acetamidoanilino)methyl]-3,3,3-trifluoropropanoic acid.
| Compound Name | 2-[(3-acetamidoanilino)methyl]-3,3,3-trifluoropropanoic acid |
|---|---|
| PubChem CID | 103233912 |
| Molecular Formula | C12H13F3N2O3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[(3-acetamidoanilino)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | CC(=O)Nc1cccc(NCC(C(=O)O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2O3/c1-7(18)17-9-4-2-3-8(5-9)16-6-10(11(19)20)12(13,14)15/h2-5,10,16H,6H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | YKWUIEBMRFJRET-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |