C33H47NO2 — CID 10323262
2-[(3S,4aS,7aS,8S,10aR,10bS)-7,7a,10b-trimethyl-8-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,4a,5,8,9,10,10a-octahydro-1H-azuleno[5,4-b]pyran-3-yl]propan-2-ol (PubChem CID 10323262) has the molecular formula C33H47NO2 and a molecular weight of 489.74 g/mol. Its IUPAC name is 2-[(3S,4aS,7aS,8S,10aR,10bS)-7,7a,10b-trimethyl-8-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,4a,5,8,9,10,10a-octahydro-1H-azuleno[5,4-b]pyran-3-yl]propan-2-ol.
| Compound Name | 2-[(3S,4aS,7aS,8S,10aR,10bS)-7,7a,10b-trimethyl-8-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,4a,5,8,9,10,10a-octahydro-1H-azuleno[5,4-b]pyran-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 10323262 |
| Molecular Formula | C33H47NO2 |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.36 |
| IUPAC Name | 2-[(3S,4aS,7aS,8S,10aR,10bS)-7,7a,10b-trimethyl-8-[[2-(2-methylbut-3-en-2-yl)-1H-indol-3-yl]methyl]-2,3,4a,5,8,9,10,10a-octahydro-1H-azuleno[5,4-b]pyran-3-yl]propan-2-ol |
| SMILES | C=CC(C)(C)c1[nH]c2ccccc2c1C[C@@H]1CC[C@H]2[C@]3(C)CC[C@@H](C(C)(C)O)O[C@H]3CC=C(C)[C@@]12C |
| InChI | InChI=1S/C33H47NO2/c1-9-30(3,4)29-24(23-12-10-11-13-25(23)34-29)20-22-15-16-26-32(7)19-18-27(31(5,6)35)36-28(32)17-14-21(2)33(22,26)8/h9-14,22,26-28,34-35H,1,15-20H2,2-8H3/t22-,26-,27-,28-,32-,33-/m0/s1 |
| InChIKey | AHUPTCAANZMABA-AFWSAFCKSA-N |
| XLogP | 7.88 |
| TPSA | 45.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|