C11H15N3O3 — CID 103233841
2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide (PubChem CID 103233841) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide.
| Compound Name | 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide |
|---|---|
| PubChem CID | 103233841 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 2-amino-3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)propanamide |
| SMILES | NC(=O)C(N)CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C11H15N3O3/c12-8(11(13)15)6-14-7-1-2-9-10(5-7)17-4-3-16-9/h1-2,5,8,14H,3-4,6,12H2,(H2,13,15) |
| InChIKey | IBZITLZXGNRDRD-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|