C6H6F3N3O2 — CID 103240543
5-amino-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 103240543) has the molecular formula C6H6F3N3O2 and a molecular weight of 209.13 g/mol. Its IUPAC name is 5-amino-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240543 |
| Molecular Formula | C6H6F3N3O2 |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-amino-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | Nc1c(OCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C6H6F3N3O2/c7-6(8,9)1-14-5-3(10)4(13)11-2-12-5/h2H,1,10H2,(H,11,12,13) |
| InChIKey | VJKPORABCDJEIU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |