C6H4F3IN2O2 — CID 114675907
5-iodo-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 114675907) has the molecular formula C6H4F3IN2O2 and a molecular weight of 320.01 g/mol. Its IUPAC name is 5-iodo-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 114675907 |
| Molecular Formula | C6H4F3IN2O2 |
| Molecular Weight | 320.01 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 5-iodo-4-(2,2,2-trifluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(OCC(F)(F)F)c1I |
| InChI | InChI=1S/C6H4F3IN2O2/c7-6(8,9)1-14-5-3(10)4(13)11-2-12-5/h2H,1H2,(H,11,12,13) |
| InChIKey | JSTNQSYHLCXBRZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.01 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|