C6H8N2O3 — CID 103240566
4,5-dimethoxy-1H-pyrimidin-6-one (PubChem CID 103240566) has the molecular formula C6H8N2O3 and a molecular weight of 156.14 g/mol. Its IUPAC name is 4,5-dimethoxy-1H-pyrimidin-6-one.
| Compound Name | 4,5-dimethoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240566 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4,5-dimethoxy-1H-pyrimidin-6-one |
| SMILES | COc1nc[nH]c(=O)c1OC |
| InChI | InChI=1S/C6H8N2O3/c1-10-4-5(9)7-3-8-6(4)11-2/h3H,1-2H3,(H,7,8,9) |
| InChIKey | SIRFOUGVYSHJDA-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |