C10H11N3O2S — CID 103240598
3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-pyrazin-2-one (PubChem CID 103240598) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-pyrazin-2-one.
| Compound Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 103240598 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]-1H-pyrazin-2-one |
| SMILES | Cc1ncsc1CCOc1ncc[nH]c1=O |
| InChI | InChI=1S/C10H11N3O2S/c1-7-8(16-6-13-7)2-5-15-10-9(14)11-3-4-12-10/h3-4,6H,2,5H2,1H3,(H,11,14) |
| InChIKey | IEYUOHOIURTJNH-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |