C11H16N2O2 — CID 103240780
4-(cyclopropylmethoxy)-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 103240780) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-(cyclopropylmethoxy)-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-(cyclopropylmethoxy)-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103240780 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 4-(cyclopropylmethoxy)-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(OCC2CC2)cc(=O)[nH]1 |
| InChI | InChI=1S/C11H16N2O2/c1-7(2)11-12-9(14)5-10(13-11)15-6-8-3-4-8/h5,7-8H,3-4,6H2,1-2H3,(H,12,13,14) |
| InChIKey | GNOCDCGLZXHJDF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |