C9H10F2N2O2 — CID 103241902
2-cyclopropyl-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one (PubChem CID 103241902) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclopropyl-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241902 |
| Molecular Formula | C9H10F2N2O2 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 2-cyclopropyl-4-(2,2-difluoroethoxy)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(OCC(F)F)nc(C2CC2)[nH]1 |
| InChI | InChI=1S/C9H10F2N2O2/c10-6(11)4-15-8-3-7(14)12-9(13-8)5-1-2-5/h3,5-6H,1-2,4H2,(H,12,13,14) |
| InChIKey | WXQKHWVECHVTQH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |