C7H8F2N2O2 — CID 103241905
4-(2,2-difluoroethoxy)-2-methyl-1H-pyrimidin-6-one (PubChem CID 103241905) has the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-difluoroethoxy)-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241905 |
| Molecular Formula | C7H8F2N2O2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(OCC(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H8F2N2O2/c1-4-10-6(12)2-7(11-4)13-3-5(8)9/h2,5H,3H2,1H3,(H,10,11,12) |
| InChIKey | UAYQNXGFWGTFIP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |