C8H7F3N2O3 — CID 123625727
[6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] propanoate (PubChem CID 123625727) has the molecular formula C8H7F3N2O3 and a molecular weight of 236.15 g/mol. Its IUPAC name is [6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] propanoate.
| Compound Name | [6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] propanoate |
|---|---|
| PubChem CID | 123625727 |
| Molecular Formula | C8H7F3N2O3 |
| Molecular Weight | 236.15 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | [6-oxo-2-(trifluoromethyl)-1H-pyrimidin-4-yl] propanoate |
| SMILES | CCC(=O)Oc1cc(=O)[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H7F3N2O3/c1-2-6(15)16-5-3-4(14)12-7(13-5)8(9,10)11/h3H,2H2,1H3,(H,12,13,14) |
| InChIKey | AFBBABSORWFWLK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.15 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |