C8H9F3N2O2 — CID 103241927
2-methyl-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one (PubChem CID 103241927) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 2-methyl-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241927 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-methyl-4-(3,3,3-trifluoropropoxy)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(OCCC(F)(F)F)cc(=O)[nH]1 |
| InChI | InChI=1S/C8H9F3N2O2/c1-5-12-6(14)4-7(13-5)15-3-2-8(9,10)11/h4H,2-3H2,1H3,(H,12,13,14) |
| InChIKey | ZBPDOVYMSUWHNB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |