C11H19N3O5 — CID 103241963
5-amino-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1H-pyrimidin-6-one (PubChem CID 103241963) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is 5-amino-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103241963 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-amino-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-1H-pyrimidin-6-one |
| SMILES | COCCOCCOCCOc1nc[nH]c(=O)c1N |
| InChI | InChI=1S/C11H19N3O5/c1-16-2-3-17-4-5-18-6-7-19-11-9(12)10(15)13-8-14-11/h8H,2-7,12H2,1H3,(H,13,14,15) |
| InChIKey | SKMKUEKGHAWFPE-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|