C8H14F3NO4S — CID 103242080
3,3,3-trifluoro-2-[(3-methylsulfonylpropylamino)methyl]propanoic acid (PubChem CID 103242080) has the molecular formula C8H14F3NO4S and a molecular weight of 277.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methylsulfonylpropylamino)methyl]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-[(3-methylsulfonylpropylamino)methyl]propanoic acid |
|---|---|
| PubChem CID | 103242080 |
| Molecular Formula | C8H14F3NO4S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-methylsulfonylpropylamino)methyl]propanoic acid |
| SMILES | CS(=O)(=O)CCCNCC(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO4S/c1-17(15,16)4-2-3-12-5-6(7(13)14)8(9,10)11/h6,12H,2-5H2,1H3,(H,13,14) |
| InChIKey | MMGLIFSCIUHYQZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|