C32H39NO5 — CID 10324283
ethyl (E)-7-[3-[[4-(diethoxymethyl)phenyl]methoxy]phenyl]-7-pyridin-3-ylhept-6-enoate (PubChem CID 10324283) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is ethyl (E)-7-[3-[[4-(diethoxymethyl)phenyl]methoxy]phenyl]-7-pyridin-3-ylhept-6-enoate.
| Compound Name | ethyl (E)-7-[3-[[4-(diethoxymethyl)phenyl]methoxy]phenyl]-7-pyridin-3-ylhept-6-enoate |
|---|---|
| PubChem CID | 10324283 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | ethyl (E)-7-[3-[[4-(diethoxymethyl)phenyl]methoxy]phenyl]-7-pyridin-3-ylhept-6-enoate |
| SMILES | CCOC(=O)CCCC/C=C(/c1cccnc1)c1cccc(OCc2ccc(C(OCC)OCC)cc2)c1 |
| InChI | InChI=1S/C32H39NO5/c1-4-35-31(34)16-9-7-8-15-30(28-13-11-21-33-23-28)27-12-10-14-29(22-27)38-24-25-17-19-26(20-18-25)32(36-5-2)37-6-3/h10-15,17-23,32H,4-9,16,24H2,1-3H3/b30-15+ |
| InChIKey | KDLOJKZGSJQRRV-FJEPWZHXSA-N |
| XLogP | 7.29 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|