C45H59NO8 — CID 10417577
ethyl (E)-7-[4-[5-[(2S,4S,5R)-5-[(Z)-6-ethoxy-6-oxohex-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]-5-methylhexoxy]phenyl]-7-pyridin-3-ylhept-6-enoate (PubChem CID 10417577) has the molecular formula C45H59NO8 and a molecular weight of 741.97 g/mol. Its IUPAC name is ethyl (E)-7-[4-[5-[(2S,4S,5R)-5-[(Z)-6-ethoxy-6-oxohex-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]-5-methylhexoxy]phenyl]-7-pyridin-3-ylhept-6-enoate.
| Compound Name | ethyl (E)-7-[4-[5-[(2S,4S,5R)-5-[(Z)-6-ethoxy-6-oxohex-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]-5-methylhexoxy]phenyl]-7-pyridin-3-ylhept-6-enoate |
|---|---|
| PubChem CID | 10417577 |
| Molecular Formula | C45H59NO8 |
| Molecular Weight | 741.97 g/mol |
| Exact Mass | 741.42 |
| IUPAC Name | ethyl (E)-7-[4-[5-[(2S,4S,5R)-5-[(Z)-6-ethoxy-6-oxohex-2-enyl]-4-(2-hydroxyphenyl)-1,3-dioxan-2-yl]-5-methylhexoxy]phenyl]-7-pyridin-3-ylhept-6-enoate |
| SMILES | CCOC(=O)CC/C=C\C[C@@H]1CO[C@H](C(C)(C)CCCCOc2ccc(/C(=C\CCCCC(=O)OCC)c3cccnc3)cc2)O[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C45H59NO8/c1-5-50-41(48)23-11-7-9-18-36-33-53-44(54-43(36)39-21-13-14-22-40(39)47)45(3,4)29-15-16-31-52-37-27-25-34(26-28-37)38(35-19-17-30-46-32-35)20-10-8-12-24-42(49)51-6-2/h7,9,13-14,17,19-22,25-28,30,32,36,43-44,47H,5-6,8,10-12,15-16,18,23-24,29,31,33H2,1-4H3/b9-7-,38-20+/t36-,43+,44+/m1/s1 |
| InChIKey | CJRSNDBDPAAANZ-VHMVITGOSA-N |
| XLogP | 9.94 |
| TPSA | 113.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.97 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|