C26H30N2O5 — CID 10343751
methyl (Z)-6-[(2S,4S,5R)-2-[2-(2-cyanophenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate (PubChem CID 10343751) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is methyl (Z)-6-[(2S,4S,5R)-2-[2-(2-cyanophenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(2S,4S,5R)-2-[2-(2-cyanophenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate |
|---|---|
| PubChem CID | 10343751 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | methyl (Z)-6-[(2S,4S,5R)-2-[2-(2-cyanophenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1CO[C@H](C(C)(C)Oc2ccccc2C#N)O[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C26H30N2O5/c1-26(2,33-22-13-8-7-10-19(22)16-27)25-31-18-21(11-5-4-6-14-23(29)30-3)24(32-25)20-12-9-15-28-17-20/h4-5,7-10,12-13,15,17,21,24-25H,6,11,14,18H2,1-3H3/b5-4-/t21-,24-,25+/m1/s1 |
| InChIKey | IAKJXCSSHHZETL-GYOFCRFXSA-N |
| XLogP | 4.74 |
| TPSA | 90.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|