C19H21NO5 — CID 10088804
(Z)-6-[(2S,4S,5R)-2-(furan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 10088804) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-2-(furan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-2-(furan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 10088804 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-2-(furan-2-yl)-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\C[C@@H]1CO[C@H](c2ccco2)O[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C19H21NO5/c21-17(22)9-3-1-2-6-15-13-24-19(16-8-5-11-23-16)25-18(15)14-7-4-10-20-12-14/h1-2,4-5,7-8,10-12,15,18-19H,3,6,9,13H2,(H,21,22)/b2-1-/t15-,18-,19+/m1/s1 |
| InChIKey | PGLLRZHYBMXBPA-BDTAUHQASA-N |
| XLogP | 3.89 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|