C26H27NO4 — CID 10454651
methyl (Z)-6-[(2S,4S,5R)-2-naphthalen-2-yl-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate (PubChem CID 10454651) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is methyl (Z)-6-[(2S,4S,5R)-2-naphthalen-2-yl-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(2S,4S,5R)-2-naphthalen-2-yl-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate |
|---|---|
| PubChem CID | 10454651 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | methyl (Z)-6-[(2S,4S,5R)-2-naphthalen-2-yl-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1CO[C@H](c2ccc3ccccc3c2)O[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C26H27NO4/c1-29-24(28)12-4-2-3-10-23-18-30-26(31-25(23)22-11-7-15-27-17-22)21-14-13-19-8-5-6-9-20(19)16-21/h2-3,5-9,11,13-17,23,25-26H,4,10,12,18H2,1H3/b3-2-/t23-,25-,26+/m1/s1 |
| InChIKey | MQHJPPMJLSFNPH-QCXBYAIASA-N |
| XLogP | 5.54 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|