C26H31NO7 — CID 10322440
(Z)-6-[(2S,4S,5R)-2-[2-(2-methoxycarbonylphenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid (PubChem CID 10322440) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is (Z)-6-[(2S,4S,5R)-2-[2-(2-methoxycarbonylphenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid.
| Compound Name | (Z)-6-[(2S,4S,5R)-2-[2-(2-methoxycarbonylphenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 10322440 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (Z)-6-[(2S,4S,5R)-2-[2-(2-methoxycarbonylphenoxy)propan-2-yl]-4-pyridin-3-yl-1,3-dioxan-5-yl]hex-4-enoic acid |
| SMILES | COC(=O)c1ccccc1OC(C)(C)[C@H]1OC[C@@H](C/C=C\CCC(=O)O)[C@@H](c2cccnc2)O1 |
| InChI | InChI=1S/C26H31NO7/c1-26(2,34-21-13-8-7-12-20(21)24(30)31-3)25-32-17-19(10-5-4-6-14-22(28)29)23(33-25)18-11-9-15-27-16-18/h4-5,7-9,11-13,15-16,19,23,25H,6,10,14,17H2,1-3H3,(H,28,29)/b5-4-/t19-,23-,25+/m1/s1 |
| InChIKey | BLQRRTMBZPZHCY-AUKLWXOLSA-N |
| XLogP | 4.57 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|