C22H35NO4Si — CID 67797765
7-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-yloxolan-3-yl]hept-4-enoic acid (PubChem CID 67797765) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is 7-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-yloxolan-3-yl]hept-4-enoic acid.
| Compound Name | 7-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-yloxolan-3-yl]hept-4-enoic acid |
|---|---|
| PubChem CID | 67797765 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 7-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-pyridin-3-yloxolan-3-yl]hept-4-enoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@H](c2cccnc2)[C@@H]1CCC=CCCC(=O)O |
| InChI | InChI=1S/C22H35NO4Si/c1-22(2,3)28(4,5)27-19-16-26-21(17-11-10-14-23-15-17)18(19)12-8-6-7-9-13-20(24)25/h6-7,10-11,14-15,18-19,21H,8-9,12-13,16H2,1-5H3,(H,24,25)/t18-,19-,21-/m1/s1 |
| InChIKey | KWAOWQMVFPNGNT-SFHLNBCPSA-N |
| XLogP | 5.36 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|