C26H36O3 — CID 91261399
(Z)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one;ethane (PubChem CID 91261399) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is (Z)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one;ethane.
| Compound Name | (Z)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one;ethane |
|---|---|
| PubChem CID | 91261399 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (Z)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one;ethane |
| SMILES | CC.CC.CC(=O)C/C=C\C[C@H]1CO[C@@H](c2ccccc2)OC1c1ccccc1 |
| InChI | InChI=1S/C22H24O3.2C2H6/c1-17(23)10-8-9-15-20-16-24-22(19-13-6-3-7-14-19)25-21(20)18-11-4-2-5-12-18;2*1-2/h2-9,11-14,20-22H,10,15-16H2,1H3;2*1-2H3/b9-8-;;/t20-,21?,22+;;/m0../s1 |
| InChIKey | GGAVOJWOKKNNQM-PTXPQTSHSA-N |
| XLogP | 7.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|