C24H25NO4 — CID 70374967
(Z)-7-[2-(2-cyanophenyl)-4-phenyl-1,3-dioxan-5-yl]hept-5-enoic acid (PubChem CID 70374967) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (Z)-7-[2-(2-cyanophenyl)-4-phenyl-1,3-dioxan-5-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[2-(2-cyanophenyl)-4-phenyl-1,3-dioxan-5-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70374967 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (Z)-7-[2-(2-cyanophenyl)-4-phenyl-1,3-dioxan-5-yl]hept-5-enoic acid |
| SMILES | N#Cc1ccccc1C1OCC(C/C=C\CCCC(=O)O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C24H25NO4/c25-16-19-12-8-9-14-21(19)24-28-17-20(13-4-1-2-7-15-22(26)27)23(29-24)18-10-5-3-6-11-18/h1,3-6,8-12,14,20,23-24H,2,7,13,15,17H2,(H,26,27)/b4-1- |
| InChIKey | YTKRAUSBNIYCDG-RJRFIUFISA-N |
| XLogP | 5.16 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|