C22H24O3 — CID 121465119
(E)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one (PubChem CID 121465119) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is (E)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one.
| Compound Name | (E)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one |
|---|---|
| PubChem CID | 121465119 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (E)-6-[(2R,4R,5S)-2,4-diphenyl-1,3-dioxan-5-yl]hex-4-en-2-one |
| SMILES | CC(=O)C/C=C/C[C@H]1CO[C@@H](c2ccccc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24O3/c1-17(23)10-8-9-15-20-16-24-22(19-13-6-3-7-14-19)25-21(20)18-11-4-2-5-12-18/h2-9,11-14,20-22H,10,15-16H2,1H3/b9-8+/t20-,21-,22+/m0/s1 |
| InChIKey | IYFOEEQLRPNYGZ-UNRVUOGPSA-N |
| XLogP | 5.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|