C8H10N2O2S — CID 103243342
(E)-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]prop-2-enoic acid (PubChem CID 103243342) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is (E)-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103243342 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (E)-3-[(2-methyl-1,3-thiazol-4-yl)methylamino]prop-2-enoic acid |
| SMILES | Cc1nc(CN/C=C/C(=O)O)cs1 |
| InChI | InChI=1S/C8H10N2O2S/c1-6-10-7(5-13-6)4-9-3-2-8(11)12/h2-3,5,9H,4H2,1H3,(H,11,12)/b3-2+ |
| InChIKey | PKTBIGNOSVSVSL-NSCUHMNNSA-N |
| XLogP | 1.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|