C34H28N2O4 — CID 10324652
2-[4-[3,3-bis(4-pyridin-2-ylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid (PubChem CID 10324652) has the molecular formula C34H28N2O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-[4-[3,3-bis(4-pyridin-2-ylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[3,3-bis(4-pyridin-2-ylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 10324652 |
| Molecular Formula | C34H28N2O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2-[4-[3,3-bis(4-pyridin-2-ylphenyl)prop-2-enoxy]-2-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC=C(c2ccc(-c3ccccn3)cc2)c2ccc(-c3ccccn3)cc2)ccc1OCC(=O)O |
| InChI | InChI=1S/C34H28N2O4/c1-24-22-29(16-17-33(24)40-23-34(37)38)39-21-18-30(25-8-12-27(13-9-25)31-6-2-4-19-35-31)26-10-14-28(15-11-26)32-7-3-5-20-36-32/h2-20,22H,21,23H2,1H3,(H,37,38) |
| InChIKey | GSTRHEMBXQKCQK-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |