C23H24FNO8 — CID 56675680
1-[(2,5-dimethoxyphenyl)methyl]-7-(2-fluoroethoxy)-6-methoxyisoquinoline;oxalic acid (PubChem CID 56675680) has the molecular formula C23H24FNO8 and a molecular weight of 461.44 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)methyl]-7-(2-fluoroethoxy)-6-methoxyisoquinoline;oxalic acid.
| Compound Name | 1-[(2,5-dimethoxyphenyl)methyl]-7-(2-fluoroethoxy)-6-methoxyisoquinoline;oxalic acid |
|---|---|
| PubChem CID | 56675680 |
| Molecular Formula | C23H24FNO8 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)methyl]-7-(2-fluoroethoxy)-6-methoxyisoquinoline;oxalic acid |
| SMILES | COc1ccc(OC)c(Cc2nccc3cc(OC)c(OCCF)cc23)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H22FNO4.C2H2O4/c1-24-16-4-5-19(25-2)15(10-16)11-18-17-13-21(27-9-7-22)20(26-3)12-14(17)6-8-23-18;3-1(4)2(5)6/h4-6,8,10,12-13H,7,9,11H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UKPOPCGUHZXFSY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|