C20H19F2NO3 — CID 54769353
7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline (PubChem CID 54769353) has the molecular formula C20H19F2NO3 and a molecular weight of 359.37 g/mol. Its IUPAC name is 7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline.
| Compound Name | 7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline |
|---|---|
| PubChem CID | 54769353 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OCCF)cc23)c(F)c1 |
| InChI | InChI=1S/C20H19F2NO3/c1-24-15-4-3-14(17(22)11-15)9-18-16-12-20(26-8-6-21)19(25-2)10-13(16)5-7-23-18/h3-5,7,10-12H,6,8-9H2,1-2H3 |
| InChIKey | QLUAKIGJRWDMDK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |