C27H23ClF2N2O5 — CID 1252374
2-chloro-N-[2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyphenyl]-4,5-difluorobenzamide (PubChem CID 1252374) has the molecular formula C27H23ClF2N2O5 and a molecular weight of 528.94 g/mol. Its IUPAC name is 2-chloro-N-[2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyphenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyphenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 1252374 |
| Molecular Formula | C27H23ClF2N2O5 |
| Molecular Weight | 528.94 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | 2-chloro-N-[2-[(6,7-dimethoxyisoquinolin-1-yl)methyl]-4,5-dimethoxyphenyl]-4,5-difluorobenzamide |
| SMILES | COc1cc(Cc2nccc3cc(OC)c(OC)cc23)c(NC(=O)c2cc(F)c(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C27H23ClF2N2O5/c1-34-23-8-14-5-6-31-22(16(14)11-25(23)36-3)7-15-9-24(35-2)26(37-4)13-21(15)32-27(33)17-10-19(29)20(30)12-18(17)28/h5-6,8-13H,7H2,1-4H3,(H,32,33) |
| InChIKey | MQRDHLFHHGEFFR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.94 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|