C22H21F2NO7 — CID 54770001
7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline;oxalic acid (PubChem CID 54770001) has the molecular formula C22H21F2NO7 and a molecular weight of 449.41 g/mol. Its IUPAC name is 7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline;oxalic acid.
| Compound Name | 7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline;oxalic acid |
|---|---|
| PubChem CID | 54770001 |
| Molecular Formula | C22H21F2NO7 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 7-(2-fluoroethoxy)-1-[(2-fluoro-4-methoxyphenyl)methyl]-6-methoxyisoquinoline;oxalic acid |
| SMILES | COc1ccc(Cc2nccc3cc(OC)c(OCCF)cc23)c(F)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H19F2NO3.C2H2O4/c1-24-15-4-3-14(17(22)11-15)9-18-16-12-20(26-8-6-21)19(25-2)10-13(16)5-7-23-18;3-1(4)2(5)6/h3-5,7,10-12H,6,8-9H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | VAVZVFCNHZDNIJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|