C9H14N4O2 — CID 103251287
methyl (E)-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoate (PubChem CID 103251287) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is methyl (E)-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoate |
|---|---|
| PubChem CID | 103251287 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | methyl (E)-3-[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCCc1nncn1C |
| InChI | InChI=1S/C9H14N4O2/c1-13-7-11-12-8(13)3-5-10-6-4-9(14)15-2/h4,6-7,10H,3,5H2,1-2H3/b6-4+ |
| InChIKey | YJGLJHDQRSNKSB-GQCTYLIASA-N |
| XLogP | -0.37 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|