C13H23NO3 — CID 103253713
methyl (E)-3-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]prop-2-enoate (PubChem CID 103253713) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is methyl (E)-3-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]prop-2-enoate |
|---|---|
| PubChem CID | 103253713 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | methyl (E)-3-[(1-hydroxy-4,4-dimethylcyclohexyl)methylamino]prop-2-enoate |
| SMILES | COC(=O)/C=C/NCC1(O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H23NO3/c1-12(2)5-7-13(16,8-6-12)10-14-9-4-11(15)17-3/h4,9,14,16H,5-8,10H2,1-3H3/b9-4+ |
| InChIKey | QDVZNRQHKRXFLU-RUDMXATFSA-N |
| XLogP | 1.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|