C10H15N3O2 — CID 103255400
(E)-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]prop-2-enoic acid (PubChem CID 103255400) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is (E)-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103255400 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (E)-3-[(1,3,5-trimethylpyrazol-4-yl)methylamino]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(C)c1CN/C=C/C(=O)O |
| InChI | InChI=1S/C10H15N3O2/c1-7-9(8(2)13(3)12-7)6-11-5-4-10(14)15/h4-5,11H,6H2,1-3H3,(H,14,15)/b5-4+ |
| InChIKey | DBAPPRBFYJLTRZ-SNAWJCMRSA-N |
| XLogP | 0.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|