C25H22OS8 — CID 10326165
[9,10-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-2-yl]methanol (PubChem CID 10326165) has the molecular formula C25H22OS8 and a molecular weight of 594.99 g/mol. Its IUPAC name is [9,10-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-2-yl]methanol.
| Compound Name | [9,10-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-2-yl]methanol |
|---|---|
| PubChem CID | 10326165 |
| Molecular Formula | C25H22OS8 |
| Molecular Weight | 594.99 g/mol |
| Exact Mass | 593.94 |
| IUPAC Name | [9,10-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]anthracen-2-yl]methanol |
| SMILES | CSC1=C(SC)SC(=c2c3ccccc3c(=C3SC(SC)=C(SC)S3)c3cc(CO)ccc23)S1 |
| InChI | InChI=1S/C25H22OS8/c1-27-22-23(28-2)32-20(31-22)18-14-7-5-6-8-15(14)19(17-11-13(12-26)9-10-16(17)18)21-33-24(29-3)25(30-4)34-21/h5-11,26H,12H2,1-4H3 |
| InChIKey | RLBJCQDDGDOFQG-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.99 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|