C9H14F3NO2 — CID 103262037
methyl (E)-3-(5,5,5-trifluoropentylamino)prop-2-enoate (PubChem CID 103262037) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is methyl (E)-3-(5,5,5-trifluoropentylamino)prop-2-enoate.
| Compound Name | methyl (E)-3-(5,5,5-trifluoropentylamino)prop-2-enoate |
|---|---|
| PubChem CID | 103262037 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl (E)-3-(5,5,5-trifluoropentylamino)prop-2-enoate |
| SMILES | COC(=O)/C=C/NCCCCC(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c1-15-8(14)4-7-13-6-3-2-5-9(10,11)12/h4,7,13H,2-3,5-6H2,1H3/b7-4+ |
| InChIKey | ZAWDIBSNKDVWPB-QPJJXVBHSA-N |
| XLogP | 2.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|