C14H26BrNO2 — CID 103263743
methyl 2-bromo-3-[(3,3,5,5-tetramethylcyclohexyl)amino]propanoate (PubChem CID 103263743) has the molecular formula C14H26BrNO2 and a molecular weight of 320.27 g/mol. Its IUPAC name is methyl 2-bromo-3-[(3,3,5,5-tetramethylcyclohexyl)amino]propanoate.
| Compound Name | methyl 2-bromo-3-[(3,3,5,5-tetramethylcyclohexyl)amino]propanoate |
|---|---|
| PubChem CID | 103263743 |
| Molecular Formula | C14H26BrNO2 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 2-bromo-3-[(3,3,5,5-tetramethylcyclohexyl)amino]propanoate |
| SMILES | COC(=O)C(Br)CNC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H26BrNO2/c1-13(2)6-10(7-14(3,4)9-13)16-8-11(15)12(17)18-5/h10-11,16H,6-9H2,1-5H3 |
| InChIKey | PLJBTBRJNFOTBF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|