C11H16N2O2S — CID 103267931
methyl 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoate (PubChem CID 103267931) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is methyl 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoate.
| Compound Name | methyl 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoate |
|---|---|
| PubChem CID | 103267931 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl 2-ethyl-4-(1,3-thiazol-5-ylmethylamino)but-2-enoate |
| SMILES | CCC(=CCNCc1cncs1)C(=O)OC |
| InChI | InChI=1S/C11H16N2O2S/c1-3-9(11(14)15-2)4-5-12-6-10-7-13-8-16-10/h4,7-8,12H,3,5-6H2,1-2H3 |
| InChIKey | RDTHCHNXIGVCRE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|