C14H16FNO4 — CID 103272807
methyl 2-[1-(4-carbamoyl-3-fluorophenoxy)cyclobutyl]acetate (PubChem CID 103272807) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is methyl 2-[1-(4-carbamoyl-3-fluorophenoxy)cyclobutyl]acetate.
| Compound Name | methyl 2-[1-(4-carbamoyl-3-fluorophenoxy)cyclobutyl]acetate |
|---|---|
| PubChem CID | 103272807 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | methyl 2-[1-(4-carbamoyl-3-fluorophenoxy)cyclobutyl]acetate |
| SMILES | COC(=O)CC1(Oc2ccc(C(N)=O)c(F)c2)CCC1 |
| InChI | InChI=1S/C14H16FNO4/c1-19-12(17)8-14(5-2-6-14)20-9-3-4-10(13(16)18)11(15)7-9/h3-4,7H,2,5-6,8H2,1H3,(H2,16,18) |
| InChIKey | SWMUTTDFWJCQGD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |