C11H22N2 — CID 103277012
2-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,1-dimethylhydrazine (PubChem CID 103277012) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 103277012 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-[(3,5-dimethylcyclohex-3-en-1-yl)methyl]-1,1-dimethylhydrazine |
| SMILES | CC1=CC(C)CC(CNN(C)C)C1 |
| InChI | InChI=1S/C11H22N2/c1-9-5-10(2)7-11(6-9)8-12-13(3)4/h5,9,11-12H,6-8H2,1-4H3 |
| InChIKey | IGCHTCIQDRWPIE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|