C17H20O2 — CID 103277171
(E)-3-(3,5-dimethylcyclohex-3-en-1-yl)-2-phenylprop-2-enoic acid (PubChem CID 103277171) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (E)-3-(3,5-dimethylcyclohex-3-en-1-yl)-2-phenylprop-2-enoic acid.
| Compound Name | (E)-3-(3,5-dimethylcyclohex-3-en-1-yl)-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 103277171 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (E)-3-(3,5-dimethylcyclohex-3-en-1-yl)-2-phenylprop-2-enoic acid |
| SMILES | CC1=CC(C)CC(/C=C(/C(=O)O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H20O2/c1-12-8-13(2)10-14(9-12)11-16(17(18)19)15-6-4-3-5-7-15/h3-8,11-12,14H,9-10H2,1-2H3,(H,18,19)/b16-11+ |
| InChIKey | NGGAVOLSUSUXBV-LFIBNONCSA-N |
| XLogP | 4.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|